C16H22O — CID 102598635
(3S,4S)-2,4-dimethyl-8-phenyloct-5-yn-3-ol (PubChem CID 102598635) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (3S,4S)-2,4-dimethyl-8-phenyloct-5-yn-3-ol.
| Compound Name | (3S,4S)-2,4-dimethyl-8-phenyloct-5-yn-3-ol |
|---|---|
| PubChem CID | 102598635 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (3S,4S)-2,4-dimethyl-8-phenyloct-5-yn-3-ol |
| SMILES | CC(C)[C@H](O)[C@@H](C)C#CCCc1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-13(2)16(17)14(3)9-7-8-12-15-10-5-4-6-11-15/h4-6,10-11,13-14,16-17H,8,12H2,1-3H3/t14-,16-/m0/s1 |
| InChIKey | WRFNYEMXDSUNOY-HOCLYGCPSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|