C17H15ClN2O — CID 154621589
(NZ)-N-[[6-chloro-3-(5-phenylpent-1-ynyl)-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 154621589) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is (NZ)-N-[[6-chloro-3-(5-phenylpent-1-ynyl)-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[6-chloro-3-(5-phenylpent-1-ynyl)-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 154621589 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (NZ)-N-[[6-chloro-3-(5-phenylpent-1-ynyl)-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1nc(Cl)ccc1C#CCCCc1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O/c18-17-12-11-15(16(20-17)13-19-21)10-6-2-5-9-14-7-3-1-4-8-14/h1,3-4,7-8,11-13,21H,2,5,9H2/b19-13- |
| InChIKey | FNEXUDWQYPFTQE-UYRXBGFRSA-N |
| XLogP | 3.92 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|