C29H29NSi — CID 71517839
trimethyl-[(Z)-5-(1-methylindol-3-yl)-3,5-diphenylpent-3-en-1-ynyl]silane (PubChem CID 71517839) has the molecular formula C29H29NSi and a molecular weight of 419.64 g/mol. Its IUPAC name is trimethyl-[(Z)-5-(1-methylindol-3-yl)-3,5-diphenylpent-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(Z)-5-(1-methylindol-3-yl)-3,5-diphenylpent-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 71517839 |
| Molecular Formula | C29H29NSi |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | trimethyl-[(Z)-5-(1-methylindol-3-yl)-3,5-diphenylpent-3-en-1-ynyl]silane |
| SMILES | Cn1cc(C(/C=C(\C#C[Si](C)(C)C)c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H29NSi/c1-30-22-28(26-17-11-12-18-29(26)30)27(24-15-9-6-10-16-24)21-25(19-20-31(2,3)4)23-13-7-5-8-14-23/h5-18,21-22,27H,1-4H3/b25-21+ |
| InChIKey | KENVEQIXEBKZOP-NJNXFGOHSA-N |
| XLogP | 7.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|