C32H22Cl3N — CID 71517838
3-[(Z)-3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-5-phenylpent-2-en-4-ynyl]-1-methylindole (PubChem CID 71517838) has the molecular formula C32H22Cl3N and a molecular weight of 526.89 g/mol. Its IUPAC name is 3-[(Z)-3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-5-phenylpent-2-en-4-ynyl]-1-methylindole.
| Compound Name | 3-[(Z)-3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-5-phenylpent-2-en-4-ynyl]-1-methylindole |
|---|---|
| PubChem CID | 71517838 |
| Molecular Formula | C32H22Cl3N |
| Molecular Weight | 526.89 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 3-[(Z)-3-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-5-phenylpent-2-en-4-ynyl]-1-methylindole |
| SMILES | Cn1cc(C(/C=C(\C#Cc2ccccc2)c2ccc(Cl)cc2)c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C32H22Cl3N/c1-36-21-30(28-9-5-6-10-32(28)36)29(27-18-17-26(34)20-31(27)35)19-24(23-13-15-25(33)16-14-23)12-11-22-7-3-2-4-8-22/h2-10,13-21,29H,1H3/b24-19+ |
| InChIKey | JHCUFOCTLAXIPJ-LYBHJNIJSA-N |
| XLogP | 9.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.89 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|