C28H30O2Si — CID 12968057
[(Z)-5,5-bis(4-methoxyphenyl)-3-phenylpent-3-en-1-ynyl]-trimethylsilane (PubChem CID 12968057) has the molecular formula C28H30O2Si and a molecular weight of 426.63 g/mol. Its IUPAC name is [(Z)-5,5-bis(4-methoxyphenyl)-3-phenylpent-3-en-1-ynyl]-trimethylsilane.
| Compound Name | [(Z)-5,5-bis(4-methoxyphenyl)-3-phenylpent-3-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 12968057 |
| Molecular Formula | C28H30O2Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [(Z)-5,5-bis(4-methoxyphenyl)-3-phenylpent-3-en-1-ynyl]-trimethylsilane |
| SMILES | COc1ccc(C(/C=C(\C#C[Si](C)(C)C)c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H30O2Si/c1-29-26-15-11-23(12-16-26)28(24-13-17-27(30-2)18-14-24)21-25(19-20-31(3,4)5)22-9-7-6-8-10-22/h6-18,21,28H,1-5H3/b25-21+ |
| InChIKey | HNVJBGNSVCOHSN-NJNXFGOHSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|