About 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene
1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene (PubChem CID 101253357) has the molecular formula C19H20OS
and a molecular weight of 296.44 g/mol. Its IUPAC name is 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene.
Molecular Properties
| Compound Name | 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene |
| PubChem CID | 101253357 |
| Molecular Formula | C19H20OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene |
| SMILES | COc1ccc(C=C=C(SC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20OS/c1-15(2)21-19(17-7-5-4-6-8-17)14-11-16-9-12-18(20-3)13-10-16/h4-13,15H,1-3H3 |
| InChIKey | HXGVDPLRPQCFPM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene?
The IUPAC name of 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene (CID 101253357) is 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene.
What is the SMILES notation for 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene?
The canonical SMILES for 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene is COc1ccc(C=C=C(SC(C)C)c2ccccc2)cc1.
What is the InChIKey of 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene?
The InChIKey is HXGVDPLRPQCFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20OS/c1-15(2)21-19(17-7-5-4-6-8-17)14-11-16-9-12-18(20-3)13-10-16/h4-13,15H,1-3H3.
What are the key properties of 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene?
1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene has a molecular weight of 296.44 g/mol, XLogP of 5.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-(3-phenyl-3-propan-2-ylsulfanylpropa-1,2-dienyl)benzene is sourced from PubChem (CID 101253357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).