C18H18 — CID 10633480
(4-methyl-1-phenylpenta-1,2-dien-3-yl)benzene (PubChem CID 10633480) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4-methyl-1-phenylpenta-1,2-dien-3-yl)benzene.
| Compound Name | (4-methyl-1-phenylpenta-1,2-dien-3-yl)benzene |
|---|---|
| PubChem CID | 10633480 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (4-methyl-1-phenylpenta-1,2-dien-3-yl)benzene |
| SMILES | CC(C)C(=C=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18/c1-15(2)18(17-11-7-4-8-12-17)14-13-16-9-5-3-6-10-16/h3-13,15H,1-2H3 |
| InChIKey | VTAHIIMWVONFBW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |