C23H20 — CID 134978580
1,5-diphenylpenta-1,2-dien-3-ylbenzene (PubChem CID 134978580) has the molecular formula C23H20 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1,5-diphenylpenta-1,2-dien-3-ylbenzene.
| Compound Name | 1,5-diphenylpenta-1,2-dien-3-ylbenzene |
|---|---|
| PubChem CID | 134978580 |
| Molecular Formula | C23H20 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1,5-diphenylpenta-1,2-dien-3-ylbenzene |
| SMILES | C(=Cc1ccccc1)=C(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20/c1-4-10-20(11-5-1)16-18-23(22-14-8-3-9-15-22)19-17-21-12-6-2-7-13-21/h1-16H,17,19H2 |
| InChIKey | DVQQGCDXYDGGCX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |