C30H28N2 — CID 6370993
(Z)-N-[(E)-1,3-diphenylpropylideneamino]-1,3-diphenylpropan-1-imine (PubChem CID 6370993) has the molecular formula C30H28N2 and a molecular weight of 416.57 g/mol. Its IUPAC name is (Z)-N-[(E)-1,3-diphenylpropylideneamino]-1,3-diphenylpropan-1-imine.
| Compound Name | (Z)-N-[(E)-1,3-diphenylpropylideneamino]-1,3-diphenylpropan-1-imine |
|---|---|
| PubChem CID | 6370993 |
| Molecular Formula | C30H28N2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (Z)-N-[(E)-1,3-diphenylpropylideneamino]-1,3-diphenylpropan-1-imine |
| SMILES | c1ccc(CC/C(=N/N=C(\CCc2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2/c1-5-13-25(14-6-1)21-23-29(27-17-9-3-10-18-27)31-32-30(28-19-11-4-12-20-28)24-22-26-15-7-2-8-16-26/h1-20H,21-24H2/b31-29-,32-30+ |
| InChIKey | AROHHHHPQBMXPI-SNQKRLHOSA-N |
| XLogP | 7.15 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|