C22H20N2 — CID 6377356
(Z)-1,2-diphenyl-N-[(Z)-1-phenylethylideneamino]ethanimine (PubChem CID 6377356) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (Z)-1,2-diphenyl-N-[(Z)-1-phenylethylideneamino]ethanimine.
| Compound Name | (Z)-1,2-diphenyl-N-[(Z)-1-phenylethylideneamino]ethanimine |
|---|---|
| PubChem CID | 6377356 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (Z)-1,2-diphenyl-N-[(Z)-1-phenylethylideneamino]ethanimine |
| SMILES | C/C(=N/N=C(\Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2/c1-18(20-13-7-3-8-14-20)23-24-22(21-15-9-4-10-16-21)17-19-11-5-2-6-12-19/h2-16H,17H2,1H3/b23-18-,24-22+ |
| InChIKey | IVIYBBWRZFZEIN-SAYYMRJBSA-N |
| XLogP | 5.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|