C16H17NO — CID 123788459
2-(1,2-diphenylethylideneamino)ethanol (PubChem CID 123788459) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(1,2-diphenylethylideneamino)ethanol.
| Compound Name | 2-(1,2-diphenylethylideneamino)ethanol |
|---|---|
| PubChem CID | 123788459 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-(1,2-diphenylethylideneamino)ethanol |
| SMILES | OCC/N=C(/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c18-12-11-17-16(15-9-5-2-6-10-15)13-14-7-3-1-4-8-14/h1-10,18H,11-13H2/b17-16- |
| InChIKey | QSODHIJMQUOIAV-MSUUIHNZSA-N |
| XLogP | 2.71 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|