C18H26N2 — CID 91449631
1,2-diphenylethylidenehydrazine;ethane (PubChem CID 91449631) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1,2-diphenylethylidenehydrazine;ethane.
| Compound Name | 1,2-diphenylethylidenehydrazine;ethane |
|---|---|
| PubChem CID | 91449631 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1,2-diphenylethylidenehydrazine;ethane |
| SMILES | CC.CC.NN=C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H14N2.2C2H6/c15-16-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12;2*1-2/h1-10H,11,15H2;2*1-2H3 |
| InChIKey | KOZHSWGFNUESMU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|