C20H17NO — CID 102323138
(E)-N-phenoxy-1,2-diphenylethanimine (PubChem CID 102323138) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (E)-N-phenoxy-1,2-diphenylethanimine.
| Compound Name | (E)-N-phenoxy-1,2-diphenylethanimine |
|---|---|
| PubChem CID | 102323138 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (E)-N-phenoxy-1,2-diphenylethanimine |
| SMILES | c1ccc(C/C(=N\Oc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17NO/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)21-22-19-14-8-3-9-15-19/h1-15H,16H2/b21-20+ |
| InChIKey | MGJXHBDZRQBUIU-QZQOTICOSA-N |
| XLogP | 4.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|