C14H18O — CID 134968681
1-(3,4-dimethylpenta-1,2-dienyl)-4-methoxybenzene (PubChem CID 134968681) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(3,4-dimethylpenta-1,2-dienyl)-4-methoxybenzene.
| Compound Name | 1-(3,4-dimethylpenta-1,2-dienyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 134968681 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-(3,4-dimethylpenta-1,2-dienyl)-4-methoxybenzene |
| SMILES | COc1ccc(C=C=C(C)C(C)C)cc1 |
| InChI | InChI=1S/C14H18O/c1-11(2)12(3)5-6-13-7-9-14(15-4)10-8-13/h6-11H,1-4H3 |
| InChIKey | XDJIVZJNJPZTHG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |