C20H28OSi2 — CID 164686963
[3-(6-methoxynaphthalen-2-yl)-1-trimethylsilylpropa-1,2-dienyl]-trimethylsilane (PubChem CID 164686963) has the molecular formula C20H28OSi2 and a molecular weight of 340.62 g/mol. Its IUPAC name is [3-(6-methoxynaphthalen-2-yl)-1-trimethylsilylpropa-1,2-dienyl]-trimethylsilane.
| Compound Name | [3-(6-methoxynaphthalen-2-yl)-1-trimethylsilylpropa-1,2-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 164686963 |
| Molecular Formula | C20H28OSi2 |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | [3-(6-methoxynaphthalen-2-yl)-1-trimethylsilylpropa-1,2-dienyl]-trimethylsilane |
| SMILES | COc1ccc2cc(C=C=C([Si](C)(C)C)[Si](C)(C)C)ccc2c1 |
| InChI | InChI=1S/C20H28OSi2/c1-21-19-12-11-17-14-16(8-10-18(17)15-19)9-13-20(22(2,3)4)23(5,6)7/h8-12,14-15H,1-7H3 |
| InChIKey | LWBZMEDIHJKJGL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|