C20H21ClOS — CID 101253359
1-[1-butylsulfanyl-3-(4-chlorophenyl)propa-1,2-dienyl]-4-methoxybenzene (PubChem CID 101253359) has the molecular formula C20H21ClOS and a molecular weight of 344.91 g/mol. Its IUPAC name is 1-[1-butylsulfanyl-3-(4-chlorophenyl)propa-1,2-dienyl]-4-methoxybenzene.
| Compound Name | 1-[1-butylsulfanyl-3-(4-chlorophenyl)propa-1,2-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101253359 |
| Molecular Formula | C20H21ClOS |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[1-butylsulfanyl-3-(4-chlorophenyl)propa-1,2-dienyl]-4-methoxybenzene |
| SMILES | CCCCSC(=C=Cc1ccc(Cl)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H21ClOS/c1-3-4-15-23-20(17-8-12-19(22-2)13-9-17)14-7-16-5-10-18(21)11-6-16/h5-13H,3-4,15H2,1-2H3 |
| InChIKey | UBFAWBBUBXTWJD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|