C18H20N2O4S — CID 10784751
5-[(Z)-3-butylsulfanyl-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 10784751) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 5-[(Z)-3-butylsulfanyl-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(Z)-3-butylsulfanyl-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 10784751 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-[(Z)-3-butylsulfanyl-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCS/C(=C\C=C1C(=O)NC(=O)NC1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-3-4-11-25-15(12-5-7-13(24-2)8-6-12)10-9-14-16(21)19-18(23)20-17(14)22/h5-10H,3-4,11H2,1-2H3,(H2,19,20,21,22,23)/b15-10- |
| InChIKey | LPKPHAHWIQHESQ-GDNBJRDFSA-N |
| XLogP | 2.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|