C14H16O2S — CID 175453170
1-ethylsulfanyl-1-(4-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 175453170) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-ethylsulfanyl-1-(4-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | 1-ethylsulfanyl-1-(4-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 175453170 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-ethylsulfanyl-1-(4-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | C=CC(=O)C=C(SCC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H16O2S/c1-4-12(15)10-14(17-5-2)11-6-8-13(16-3)9-7-11/h4,6-10H,1,5H2,2-3H3 |
| InChIKey | OYPVTVCCNFJRLV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|