C20H28O2S2 — CID 154718589
(4E)-1,1-bis(ethylsulfanyl)-2-(4-methoxyphenyl)-6,6-dimethylhepta-1,4-dien-3-one (PubChem CID 154718589) has the molecular formula C20H28O2S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is (4E)-1,1-bis(ethylsulfanyl)-2-(4-methoxyphenyl)-6,6-dimethylhepta-1,4-dien-3-one.
| Compound Name | (4E)-1,1-bis(ethylsulfanyl)-2-(4-methoxyphenyl)-6,6-dimethylhepta-1,4-dien-3-one |
|---|---|
| PubChem CID | 154718589 |
| Molecular Formula | C20H28O2S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (4E)-1,1-bis(ethylsulfanyl)-2-(4-methoxyphenyl)-6,6-dimethylhepta-1,4-dien-3-one |
| SMILES | CCSC(SCC)=C(C(=O)/C=C/C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H28O2S2/c1-7-23-19(24-8-2)18(17(21)13-14-20(3,4)5)15-9-11-16(22-6)12-10-15/h9-14H,7-8H2,1-6H3/b14-13+ |
| InChIKey | FUPLAYKTWVJHNO-BUHFOSPRSA-N |
| XLogP | 6.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|