C34H32O3S2 — CID 172559168
[1,1-bis(ethylsulfanyl)-3,4,4-triphenylbuta-1,3-dien-2-yl] 4-methoxybenzoate (PubChem CID 172559168) has the molecular formula C34H32O3S2 and a molecular weight of 552.76 g/mol. Its IUPAC name is [1,1-bis(ethylsulfanyl)-3,4,4-triphenylbuta-1,3-dien-2-yl] 4-methoxybenzoate.
| Compound Name | [1,1-bis(ethylsulfanyl)-3,4,4-triphenylbuta-1,3-dien-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 172559168 |
| Molecular Formula | C34H32O3S2 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | [1,1-bis(ethylsulfanyl)-3,4,4-triphenylbuta-1,3-dien-2-yl] 4-methoxybenzoate |
| SMILES | CCSC(SCC)=C(OC(=O)c1ccc(OC)cc1)C(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H32O3S2/c1-4-38-34(39-5-2)32(37-33(35)28-21-23-29(36-3)24-22-28)31(27-19-13-8-14-20-27)30(25-15-9-6-10-16-25)26-17-11-7-12-18-26/h6-24H,4-5H2,1-3H3 |
| InChIKey | VVEHBDGUQNLSPW-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|