C33H44O2SSi — CID 52915463
[(3Z)-3-[butylsulfanyl-(4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)penta-1,4-diynyl]-tri(propan-2-yl)silane (PubChem CID 52915463) has the molecular formula C33H44O2SSi and a molecular weight of 532.87 g/mol. Its IUPAC name is [(3Z)-3-[butylsulfanyl-(4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)penta-1,4-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3Z)-3-[butylsulfanyl-(4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)penta-1,4-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 52915463 |
| Molecular Formula | C33H44O2SSi |
| Molecular Weight | 532.87 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | [(3Z)-3-[butylsulfanyl-(4-methoxyphenyl)methylidene]-5-(4-methoxyphenyl)penta-1,4-diynyl]-tri(propan-2-yl)silane |
| SMILES | CCCCS/C(=C(/C#Cc1ccc(OC)cc1)C#C[Si](C(C)C)(C(C)C)C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C33H44O2SSi/c1-10-11-23-36-33(29-16-20-32(35-9)21-17-29)30(15-12-28-13-18-31(34-8)19-14-28)22-24-37(25(2)3,26(4)5)27(6)7/h13-14,16-21,25-27H,10-11,23H2,1-9H3/b33-30- |
| InChIKey | QPBOTRIDBCSQPK-MEIHLTSWSA-N |
| XLogP | 9.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.87 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|