C31H42OSi — CID 11167088
2-[2-[4,4-dideuterio-3-(4-methoxyphenyl)hepta-1,2-dienyl]phenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 11167088) has the molecular formula C31H42OSi and a molecular weight of 460.77 g/mol. Its IUPAC name is 2-[2-[4,4-dideuterio-3-(4-methoxyphenyl)hepta-1,2-dienyl]phenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[2-[4,4-dideuterio-3-(4-methoxyphenyl)hepta-1,2-dienyl]phenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11167088 |
| Molecular Formula | C31H42OSi |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 2-[2-[4,4-dideuterio-3-(4-methoxyphenyl)hepta-1,2-dienyl]phenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | [2H]C([2H])(CCC)C(=C=Cc1ccccc1C#C[Si](C(C)C)(C(C)C)C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C31H42OSi/c1-9-10-13-27(30-18-20-31(32-8)21-19-30)16-17-28-14-11-12-15-29(28)22-23-33(24(2)3,25(4)5)26(6)7/h11-12,14-15,17-21,24-26H,9-10,13H2,1-8H3/i13D2 |
| InChIKey | CXLNUVHFGJKRQP-KLTYLHELSA-N |
| XLogP | 9.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|