C38H56N2O2Si2 — CID 15417782
3-N,4-N-bis(4-methoxyphenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine (PubChem CID 15417782) has the molecular formula C38H56N2O2Si2 and a molecular weight of 629.05 g/mol. Its IUPAC name is 3-N,4-N-bis(4-methoxyphenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine.
| Compound Name | 3-N,4-N-bis(4-methoxyphenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine |
|---|---|
| PubChem CID | 15417782 |
| Molecular Formula | C38H56N2O2Si2 |
| Molecular Weight | 629.05 g/mol |
| Exact Mass | 628.39 |
| IUPAC Name | 3-N,4-N-bis(4-methoxyphenyl)-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine |
| SMILES | COc1ccc(/N=C(C#C[Si](C(C)C)(C(C)C)C(C)C)/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=N/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H56N2O2Si2/c1-27(2)43(28(3)4,29(5)6)25-23-37(39-33-15-19-35(41-13)20-16-33)38(40-34-17-21-36(42-14)22-18-34)24-26-44(30(7)8,31(9)10)32(11)12/h15-22,27-32H,1-14H3/b39-37+,40-38+ |
| InChIKey | RMXDWYJNKUGFTN-HVMBLDELSA-N |
| XLogP | 10.99 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.05 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|