C22H23N3O3 — CID 12737122
1,2,3-tris(4-methoxyphenyl)guanidine (PubChem CID 12737122) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1,2,3-tris(4-methoxyphenyl)guanidine.
| Compound Name | 1,2,3-tris(4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 12737122 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1,2,3-tris(4-methoxyphenyl)guanidine |
| SMILES | COc1ccc(N=C(Nc2ccc(OC)cc2)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-26-19-10-4-16(5-11-19)23-22(24-17-6-12-20(27-2)13-7-17)25-18-8-14-21(28-3)15-9-18/h4-15H,1-3H3,(H2,23,24,25) |
| InChIKey | BEMSZYDWGYLQKA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|