About 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride
2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride (PubChem CID 163339871) has the molecular formula C21H20Cl2N2O
and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride |
| PubChem CID | 163339871 |
| Molecular Formula | C21H20Cl2N2O |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride |
| SMILES | COc1ccc(N/C(=N/c2ccc(C)cc2)c2ccccc2Cl)cc1.Cl |
| InChI | InChI=1S/C21H19ClN2O.ClH/c1-15-7-9-16(10-8-15)23-21(19-5-3-4-6-20(19)22)24-17-11-13-18(25-2)14-12-17;/h3-14H,1-2H3,(H,23,24);1H |
| InChIKey | XBIWWHPQBNSDGR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride?
The IUPAC name of 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride (CID 163339871) is 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride.
What is the SMILES notation for 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride?
The canonical SMILES for 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride is COc1ccc(N/C(=N/c2ccc(C)cc2)c2ccccc2Cl)cc1.Cl.
What is the InChIKey of 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride?
The InChIKey is XBIWWHPQBNSDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN2O.ClH/c1-15-7-9-16(10-8-15)23-21(19-5-3-4-6-20(19)22)24-17-11-13-18(25-2)14-12-17;/h3-14H,1-2H3,(H,23,24);1H.
What are the key properties of 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride?
2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride has a molecular weight of 387.31 g/mol, XLogP of 6.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(4-methoxyphenyl)-N'-(4-methylphenyl)benzenecarboximidamide;hydrochloride is sourced from PubChem (CID 163339871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).