C25H22N2 — CID 3345579
N,N'-bis(4-methylphenyl)naphthalene-1-carboximidamide (PubChem CID 3345579) has the molecular formula C25H22N2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N,N'-bis(4-methylphenyl)naphthalene-1-carboximidamide.
| Compound Name | N,N'-bis(4-methylphenyl)naphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 3345579 |
| Molecular Formula | C25H22N2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N,N'-bis(4-methylphenyl)naphthalene-1-carboximidamide |
| SMILES | Cc1ccc(/N=C(\Nc2ccc(C)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H22N2/c1-18-10-14-21(15-11-18)26-25(27-22-16-12-19(2)13-17-22)24-9-5-7-20-6-3-4-8-23(20)24/h3-17H,1-2H3,(H,26,27) |
| InChIKey | LCKGQJOEHXQJOZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|