C25H31N2O2+ — CID 143173959
dimethyl(oxan-4-yl)azanium;N-(4-methylphenyl)naphthalene-1-carboxamide (PubChem CID 143173959) has the molecular formula C25H31N2O2+ and a molecular weight of 391.54 g/mol. Its IUPAC name is dimethyl(oxan-4-yl)azanium;N-(4-methylphenyl)naphthalene-1-carboxamide.
| Compound Name | dimethyl(oxan-4-yl)azanium;N-(4-methylphenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 143173959 |
| Molecular Formula | C25H31N2O2+ |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | dimethyl(oxan-4-yl)azanium;N-(4-methylphenyl)naphthalene-1-carboxamide |
| SMILES | C[NH+](C)C1CCOCC1.Cc1ccc(NC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H15NO.C7H15NO/c1-13-9-11-15(12-10-13)19-18(20)17-8-4-6-14-5-2-3-7-16(14)17;1-8(2)7-3-5-9-6-4-7/h2-12H,1H3,(H,19,20);7H,3-6H2,1-2H3/p+1 |
| InChIKey | DRHGXLCVUDBIJY-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |