C25H23ClN2O4 — CID 15734501
ethyl 4-[[C-(2-chlorophenyl)-N-(4-ethoxycarbonylphenyl)carbonimidoyl]amino]benzoate (PubChem CID 15734501) has the molecular formula C25H23ClN2O4 and a molecular weight of 450.92 g/mol. Its IUPAC name is ethyl 4-[[C-(2-chlorophenyl)-N-(4-ethoxycarbonylphenyl)carbonimidoyl]amino]benzoate.
| Compound Name | ethyl 4-[[C-(2-chlorophenyl)-N-(4-ethoxycarbonylphenyl)carbonimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 15734501 |
| Molecular Formula | C25H23ClN2O4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | ethyl 4-[[C-(2-chlorophenyl)-N-(4-ethoxycarbonylphenyl)carbonimidoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C(/Nc2ccc(C(=O)OCC)cc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H23ClN2O4/c1-3-31-24(29)17-9-13-19(14-10-17)27-23(21-7-5-6-8-22(21)26)28-20-15-11-18(12-16-20)25(30)32-4-2/h5-16H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | RCBLMNOZPCXJRL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|