C15H11Cl2F3N2O — CID 10473868
N-(3,4-dichlorophenyl)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide (PubChem CID 10473868) has the molecular formula C15H11Cl2F3N2O and a molecular weight of 363.17 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 10473868 |
| Molecular Formula | C15H11Cl2F3N2O |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide |
| SMILES | COc1ccc(/N=C(/Nc2ccc(Cl)c(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11Cl2F3N2O/c1-23-11-5-2-9(3-6-11)21-14(15(18,19)20)22-10-4-7-12(16)13(17)8-10/h2-8H,1H3,(H,21,22) |
| InChIKey | CTWKAPHXDKHXJO-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|