C23H20Cl2N2O2 — CID 6265596
N-[(E)-1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)iminoprop-1-enyl]-4-methoxyaniline (PubChem CID 6265596) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is N-[(E)-1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)iminoprop-1-enyl]-4-methoxyaniline.
| Compound Name | N-[(E)-1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)iminoprop-1-enyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 6265596 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[(E)-1-(3,4-dichlorophenyl)-3-(4-methoxyphenyl)iminoprop-1-enyl]-4-methoxyaniline |
| SMILES | COc1ccc(/N=C/C=C(/Nc2ccc(OC)cc2)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H20Cl2N2O2/c1-28-19-8-4-17(5-9-19)26-14-13-23(16-3-12-21(24)22(25)15-16)27-18-6-10-20(29-2)11-7-18/h3-15,27H,1-2H3/b23-13+,26-14+ |
| InChIKey | PTCCZEJMFFWAMS-OHQCDDMMSA-N |
| XLogP | 6.87 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|