C21H15Cl4N2+ — CID 6816553
[3-(4-chloroanilino)-3-(3,4-dichlorophenyl)prop-2-enylidene]-(4-chlorophenyl)azanium (PubChem CID 6816553) has the molecular formula C21H15Cl4N2+ and a molecular weight of 437.18 g/mol. Its IUPAC name is [3-(4-chloroanilino)-3-(3,4-dichlorophenyl)prop-2-enylidene]-(4-chlorophenyl)azanium.
| Compound Name | [3-(4-chloroanilino)-3-(3,4-dichlorophenyl)prop-2-enylidene]-(4-chlorophenyl)azanium |
|---|---|
| PubChem CID | 6816553 |
| Molecular Formula | C21H15Cl4N2+ |
| Molecular Weight | 437.18 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | [3-(4-chloroanilino)-3-(3,4-dichlorophenyl)prop-2-enylidene]-(4-chlorophenyl)azanium |
| SMILES | Clc1ccc(NC(=C/C=[NH+]/c2ccc(Cl)cc2)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H14Cl4N2/c22-15-2-6-17(7-3-15)26-12-11-21(14-1-10-19(24)20(25)13-14)27-18-8-4-16(23)5-9-18/h1-13,27H/p+1/b21-11?,26-12+ |
| InChIKey | MEDBKPAFNMCXLE-BOGCGAIESA-O |
| XLogP | 6.24 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.18 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|