C10H8Cl2N2 — CID 67809240
(Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enenitrile (PubChem CID 67809240) has the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. Its IUPAC name is (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 67809240 |
| Molecular Formula | C10H8Cl2N2 |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (Z)-3-(3,4-dichlorophenyl)-3-(methylamino)prop-2-enenitrile |
| SMILES | CN/C(=C\C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2N2/c1-14-10(4-5-13)7-2-3-8(11)9(12)6-7/h2-4,6,14H,1H3/b10-4- |
| InChIKey | GSPVTGCIMUXMGN-WMZJFQQLSA-N |
| XLogP | 3.08 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|