C12H8Cl2N2 — CID 163455880
2-[1-(3,4-dichlorophenyl)propylidene]propanedinitrile (PubChem CID 163455880) has the molecular formula C12H8Cl2N2 and a molecular weight of 251.12 g/mol. Its IUPAC name is 2-[1-(3,4-dichlorophenyl)propylidene]propanedinitrile.
| Compound Name | 2-[1-(3,4-dichlorophenyl)propylidene]propanedinitrile |
|---|---|
| PubChem CID | 163455880 |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-[1-(3,4-dichlorophenyl)propylidene]propanedinitrile |
| SMILES | CCC(=C(C#N)C#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2/c1-2-10(9(6-15)7-16)8-3-4-11(13)12(14)5-8/h3-5H,2H2,1H3 |
| InChIKey | BKKZCJOUMMJMJB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|