C23H15F7N2 — CID 3579255
N-[1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]iminoprop-1-enyl]-4-(trifluoromethyl)aniline (PubChem CID 3579255) has the molecular formula C23H15F7N2 and a molecular weight of 452.37 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]iminoprop-1-enyl]-4-(trifluoromethyl)aniline.
| Compound Name | N-[1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]iminoprop-1-enyl]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3579255 |
| Molecular Formula | C23H15F7N2 |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]iminoprop-1-enyl]-4-(trifluoromethyl)aniline |
| SMILES | Fc1ccc(C(=C/C=N/c2ccc(C(F)(F)F)cc2)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H15F7N2/c24-18-7-1-15(2-8-18)21(32-20-11-5-17(6-12-20)23(28,29)30)13-14-31-19-9-3-16(4-10-19)22(25,26)27/h1-14,32H/b21-13?,31-14+ |
| InChIKey | NRXODAOGERLGLD-SDEBCNEGSA-N |
| XLogP | 7.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|