C13H10F2N2 — CID 101435045
N,N'-bis(4-fluorophenyl)methanimidamide (PubChem CID 101435045) has the molecular formula C13H10F2N2 and a molecular weight of 234.22 g/mol. Its IUPAC name is N,N'-bis(4-fluorophenyl)methanimidamide.
| Compound Name | N,N'-bis(4-fluorophenyl)methanimidamide |
|---|---|
| PubChem CID | 101435045 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N,N'-bis(4-fluorophenyl)methanimidamide |
| SMILES | Fc1ccc(/[15N]=C/[15NH]c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C13H10F2N2/c14-10-1-5-12(6-2-10)16-9-17-13-7-3-11(15)4-8-13/h1-9H,(H,16,17)/i16+1,17+1 |
| InChIKey | PCHZKCUZOPHXSZ-JVQNMGKOSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|