C15H12F4N2 — CID 2766783
N-(4-fluorophenyl)-N'-methyl-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 2766783) has the molecular formula C15H12F4N2 and a molecular weight of 296.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-methyl-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N-(4-fluorophenyl)-N'-methyl-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 2766783 |
| Molecular Formula | C15H12F4N2 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(4-fluorophenyl)-N'-methyl-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | C/N=C(/Nc1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F4N2/c1-20-14(21-13-7-5-12(16)6-8-13)10-3-2-4-11(9-10)15(17,18)19/h2-9H,1H3,(H,20,21) |
| InChIKey | MHJYVJCYXZIEKA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|