C16H10F3NO — CID 3751377
N-(4-ethynylphenyl)-3-(trifluoromethyl)benzamide (PubChem CID 3751377) has the molecular formula C16H10F3NO and a molecular weight of 289.26 g/mol. Its IUPAC name is N-(4-ethynylphenyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(4-ethynylphenyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3751377 |
| Molecular Formula | C16H10F3NO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-(4-ethynylphenyl)-3-(trifluoromethyl)benzamide |
| SMILES | C#Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H10F3NO/c1-2-11-6-8-14(9-7-11)20-15(21)12-4-3-5-13(10-12)16(17,18)19/h1,3-10H,(H,20,21) |
| InChIKey | WINJEOVJEONGEJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|