C12H10F3NO — CID 90221391
5,5,5-trifluoro-N-(4-methoxyphenyl)pent-3-yn-2-imine (PubChem CID 90221391) has the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-(4-methoxyphenyl)pent-3-yn-2-imine.
| Compound Name | 5,5,5-trifluoro-N-(4-methoxyphenyl)pent-3-yn-2-imine |
|---|---|
| PubChem CID | 90221391 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5,5,5-trifluoro-N-(4-methoxyphenyl)pent-3-yn-2-imine |
| SMILES | COc1ccc(/N=C(\C)C#CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3NO/c1-9(7-8-12(13,14)15)16-10-3-5-11(17-2)6-4-10/h3-6H,1-2H3/b16-9+ |
| InChIKey | DUXCERUPTNDJSF-CXUHLZMHSA-N |
| XLogP | 3.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|