C10H7F3N2O — CID 102573910
2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl cyanide (PubChem CID 102573910) has the molecular formula C10H7F3N2O and a molecular weight of 228.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl cyanide.
| Compound Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 102573910 |
| Molecular Formula | C10H7F3N2O |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimidoyl cyanide |
| SMILES | COc1ccc(/N=C(\C#N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F3N2O/c1-16-8-4-2-7(3-5-8)15-9(6-14)10(11,12)13/h2-5H,1H3/b15-9+ |
| InChIKey | KNIKGKOVKGYPSG-OQLLNIDSSA-N |
| XLogP | 2.85 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|