C15H22F3NOSi — CID 10543533
1-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimine (PubChem CID 10543533) has the molecular formula C15H22F3NOSi and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimine.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 10543533 |
| Molecular Formula | C15H22F3NOSi |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]-2,2,2-trifluoro-N-(4-methoxyphenyl)ethanimine |
| SMILES | COc1ccc(/N=C(\C(F)(F)F)[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22F3NOSi/c1-14(2,3)21(5,6)13(15(16,17)18)19-11-7-9-12(20-4)10-8-11/h7-10H,1-6H3/b19-13+ |
| InChIKey | VKAFYJUTMYLMPM-CPNJWEJPSA-N |
| XLogP | 5.38 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|