C17H17F3N2O3 — CID 10618093
N-(4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide (PubChem CID 10618093) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is N-(4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide.
| Compound Name | N-(4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 10618093 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-(4,4-dimethoxycyclohexa-2,5-dien-1-ylidene)-2,2,2-trifluoro-N'-(4-methoxyphenyl)ethanimidamide |
| SMILES | COc1ccc(/N=C(/N=C2C=CC(OC)(OC)C=C2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O3/c1-23-14-6-4-12(5-7-14)21-15(17(18,19)20)22-13-8-10-16(24-2,25-3)11-9-13/h4-11H,1-3H3/b21-15+ |
| InChIKey | LBUXFMAFYJBZPS-RCCKNPSSSA-N |
| XLogP | 3.84 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|