C13H16F3NO — CID 102053586
1,1,1-trifluoro-N-(4-methoxyphenyl)hexan-2-imine (PubChem CID 102053586) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(4-methoxyphenyl)hexan-2-imine.
| Compound Name | 1,1,1-trifluoro-N-(4-methoxyphenyl)hexan-2-imine |
|---|---|
| PubChem CID | 102053586 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1,1,1-trifluoro-N-(4-methoxyphenyl)hexan-2-imine |
| SMILES | CCCC/C(=N\c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c1-3-4-5-12(13(14,15)16)17-10-6-8-11(18-2)9-7-10/h6-9H,3-5H2,1-2H3/b17-12+ |
| InChIKey | SLQGAHHIAGGINV-SFQUDFHCSA-N |
| XLogP | 4.52 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|