C16H14BrF2NO2 — CID 135006703
2-bromo-2,2-difluoro-1-(3-methoxyphenyl)-N-(4-methoxyphenyl)ethanimine (PubChem CID 135006703) has the molecular formula C16H14BrF2NO2 and a molecular weight of 370.19 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-1-(3-methoxyphenyl)-N-(4-methoxyphenyl)ethanimine.
| Compound Name | 2-bromo-2,2-difluoro-1-(3-methoxyphenyl)-N-(4-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 135006703 |
| Molecular Formula | C16H14BrF2NO2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-bromo-2,2-difluoro-1-(3-methoxyphenyl)-N-(4-methoxyphenyl)ethanimine |
| SMILES | COc1ccc(/N=C(/c2cccc(OC)c2)C(F)(F)Br)cc1 |
| InChI | InChI=1S/C16H14BrF2NO2/c1-21-13-8-6-12(7-9-13)20-15(16(17,18)19)11-4-3-5-14(10-11)22-2/h3-10H,1-2H3/b20-15- |
| InChIKey | PXFCOHYWZSNPBY-HKWRFOASSA-N |
| XLogP | 4.81 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|