C28H24O2S2 — CID 14909159
1-methoxy-4-[(E)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethenyl]sulfanylbenzene (PubChem CID 14909159) has the molecular formula C28H24O2S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethenyl]sulfanylbenzene.
| Compound Name | 1-methoxy-4-[(E)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethenyl]sulfanylbenzene |
|---|---|
| PubChem CID | 14909159 |
| Molecular Formula | C28H24O2S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-methoxy-4-[(E)-2-(4-methoxyphenyl)sulfanyl-1,2-diphenylethenyl]sulfanylbenzene |
| SMILES | COc1ccc(S/C(=C(/Sc2ccc(OC)cc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O2S2/c1-29-23-13-17-25(18-14-23)31-27(21-9-5-3-6-10-21)28(22-11-7-4-8-12-22)32-26-19-15-24(30-2)16-20-26/h3-20H,1-2H3/b28-27+ |
| InChIKey | RXPXSDYOSXKXEQ-BYYHNAKLSA-N |
| XLogP | 8.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|