C27H22OSe2 — CID 71551226
1-methoxy-4-[(E)-2-phenyl-1,2-bis(phenylselanyl)ethenyl]benzene (PubChem CID 71551226) has the molecular formula C27H22OSe2 and a molecular weight of 520.39 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-2-phenyl-1,2-bis(phenylselanyl)ethenyl]benzene.
| Compound Name | 1-methoxy-4-[(E)-2-phenyl-1,2-bis(phenylselanyl)ethenyl]benzene |
|---|---|
| PubChem CID | 71551226 |
| Molecular Formula | C27H22OSe2 |
| Molecular Weight | 520.39 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | 1-methoxy-4-[(E)-2-phenyl-1,2-bis(phenylselanyl)ethenyl]benzene |
| SMILES | COc1ccc(/C([Se]c2ccccc2)=C(\[Se]c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22OSe2/c1-28-23-19-17-22(18-20-23)27(30-25-15-9-4-10-16-25)26(21-11-5-2-6-12-21)29-24-13-7-3-8-14-24/h2-20H,1H3/b27-26+ |
| InChIKey | RCZKQOHYCVBYPU-CYYJNZCTSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|