C31H26O2Se2 — CID 57408707
1-(4-methoxyphenyl)-4-phenyl-4-phenylselanyl-2-(2-phenylselanylethyl)buta-2,3-dien-1-one (PubChem CID 57408707) has the molecular formula C31H26O2Se2 and a molecular weight of 588.47 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-phenyl-4-phenylselanyl-2-(2-phenylselanylethyl)buta-2,3-dien-1-one.
| Compound Name | 1-(4-methoxyphenyl)-4-phenyl-4-phenylselanyl-2-(2-phenylselanylethyl)buta-2,3-dien-1-one |
|---|---|
| PubChem CID | 57408707 |
| Molecular Formula | C31H26O2Se2 |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-phenyl-4-phenylselanyl-2-(2-phenylselanylethyl)buta-2,3-dien-1-one |
| SMILES | COc1ccc(C(=O)C(=C=C([Se]c2ccccc2)c2ccccc2)CC[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26O2Se2/c1-33-27-19-17-25(18-20-27)31(32)26(21-22-34-28-13-7-3-8-14-28)23-30(24-11-5-2-6-12-24)35-29-15-9-4-10-16-29/h2-20H,21-22H2,1H3 |
| InChIKey | FANHYOVQLXEJBX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|