C28H34O2Si — CID 102313834
[(Z)-3-(4-methoxyphenyl)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-1-enoxy]-trimethylsilane (PubChem CID 102313834) has the molecular formula C28H34O2Si and a molecular weight of 430.66 g/mol. Its IUPAC name is [(Z)-3-(4-methoxyphenyl)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-1-enoxy]-trimethylsilane.
| Compound Name | [(Z)-3-(4-methoxyphenyl)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-1-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102313834 |
| Molecular Formula | C28H34O2Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [(Z)-3-(4-methoxyphenyl)-1-phenyl-3-(2,4,6-trimethylphenyl)prop-1-enoxy]-trimethylsilane |
| SMILES | COc1ccc(C(/C=C(\O[Si](C)(C)C)c2ccccc2)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C28H34O2Si/c1-20-17-21(2)28(22(3)18-20)26(23-13-15-25(29-4)16-14-23)19-27(30-31(5,6)7)24-11-9-8-10-12-24/h8-19,26H,1-7H3/b27-19- |
| InChIKey | SOKAGXTWZCBUJY-DIBXZPPDSA-N |
| XLogP | 7.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|