C27H34Si — CID 102204409
[(3Z)-3-[(Z)-2,3-diphenylprop-2-enylidene]non-1-ynyl]-trimethylsilane (PubChem CID 102204409) has the molecular formula C27H34Si and a molecular weight of 386.66 g/mol. Its IUPAC name is [(3Z)-3-[(Z)-2,3-diphenylprop-2-enylidene]non-1-ynyl]-trimethylsilane.
| Compound Name | [(3Z)-3-[(Z)-2,3-diphenylprop-2-enylidene]non-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 102204409 |
| Molecular Formula | C27H34Si |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | [(3Z)-3-[(Z)-2,3-diphenylprop-2-enylidene]non-1-ynyl]-trimethylsilane |
| SMILES | CCCCCC/C(C#C[Si](C)(C)C)=C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34Si/c1-5-6-7-10-17-25(20-21-28(2,3)4)23-27(26-18-13-9-14-19-26)22-24-15-11-8-12-16-24/h8-9,11-16,18-19,22-23H,5-7,10,17H2,1-4H3/b25-23-,27-22- |
| InChIKey | NCNSBPANQPNQGT-RNGJXVJCSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|