C16H20Si — CID 101267060
trimethyl-[(3E,5Z)-5-methyl-6-phenylhexa-3,5-dien-1-ynyl]silane (PubChem CID 101267060) has the molecular formula C16H20Si and a molecular weight of 240.42 g/mol. Its IUPAC name is trimethyl-[(3E,5Z)-5-methyl-6-phenylhexa-3,5-dien-1-ynyl]silane.
| Compound Name | trimethyl-[(3E,5Z)-5-methyl-6-phenylhexa-3,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 101267060 |
| Molecular Formula | C16H20Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | trimethyl-[(3E,5Z)-5-methyl-6-phenylhexa-3,5-dien-1-ynyl]silane |
| SMILES | CC(=C/c1ccccc1)/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H20Si/c1-15(10-8-9-13-17(2,3)4)14-16-11-6-5-7-12-16/h5-8,10-12,14H,1-4H3/b10-8+,15-14- |
| InChIKey | FFYNIXMKBINWJZ-XVEJLWQSSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|