C19H22OSi — CID 11077264
(Z,5E)-5-benzylidene-9-trimethylsilylnon-6-en-3,8-diyn-1-ol (PubChem CID 11077264) has the molecular formula C19H22OSi and a molecular weight of 294.47 g/mol. Its IUPAC name is (Z,5E)-5-benzylidene-9-trimethylsilylnon-6-en-3,8-diyn-1-ol.
| Compound Name | (Z,5E)-5-benzylidene-9-trimethylsilylnon-6-en-3,8-diyn-1-ol |
|---|---|
| PubChem CID | 11077264 |
| Molecular Formula | C19H22OSi |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (Z,5E)-5-benzylidene-9-trimethylsilylnon-6-en-3,8-diyn-1-ol |
| SMILES | C[Si](C)(C)C#C/C=C\C(C#CCCO)=C/c1ccccc1 |
| InChI | InChI=1S/C19H22OSi/c1-21(2,3)16-10-8-14-19(13-7-9-15-20)17-18-11-5-4-6-12-18/h4-6,8,11-12,14,17,20H,9,15H2,1-3H3/b14-8-,19-17- |
| InChIKey | QVEXXIHPNCTGNZ-QEEYBCOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|